| Name |
3,5,7-Trihydroxy-8-methoxyflavone 8-Methoxygalangin 8-Hydroxygalangin 8-methyl ether 3-Hydroxywogonin 3,5,7-Trihydroxy-8-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
5928-42-7 |
| C_ID |
C00004554
, 
|
| InChIKey |
NAENHANDGVDMPA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-15-10(18)7-9(17)11-12(19)13(20)14(22-16(11)15)8-5-3-2-4-6-8/h2-7,17-18,20H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccccc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
|
|
zoom in
| Organism | Platanus acerifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Proksch,Phytochem.,21,(1982),1835 |
|---|
|