| Name |
Hymenoxin 5,7-Dihydroxy-6,8,3',4'-tetramethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
56003-01-1 |
| C_ID |
C00003934
, 
|
| InChIKey |
QCOSAYZZNVASNN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-11-6-5-9(7-13(11)24-2)12-8-10(20)14-15(21)18(25-3)16(22)19(26-4)17(14)27-12/h5-8,21-22H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)c(OC)c3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helianthus angustifolius | Ref. |
| Plantae | Asteraceae | Hymenoxys linearifolia | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Phoebanthus tenuifolius | Ref. |
| Plantae | Asteraceae | Tithonia calva | Ref. |
| Plantae | Asteraceae | Viguiera greggii | Ref. |
| Plantae | Asteraceae | Viguiera rosei | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis  | Ref. |
| Plantae | Rutaceae | Citrus tangerina  | Ref. |
|
|
zoom in
| Organism | Viguiera greggii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Thomas,J.Org.Chem.,32,(1967),3254
Schilling,Biochem.Syst.Ecol.,16,(1988),413 |
|---|
|