| Name |
Herbacetin |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
527-95-7 |
| C_ID |
C00001048
, 
|
| InChIKey |
ZDOTZEDNGNPOEW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2c(O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium gracile | Ref. |
| Plantae | Asteraceae | Ozothamnus hookeri | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Sedum album  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra aphylla | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Equisetaceae | Equisetum fluviatile | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Papaveraceae | Meconopsis paniculata | Ref. |
| Plantae | Phrymaceae | Mimulus luteus | Ref. |
| Plantae | Primulaceae | Primula alpicola | Ref. |
| Plantae | Rosaceae | Crataegus curvisepala  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Zygophyllaceae | Fagonia alba | Ref. |
| Plantae | Zygophyllaceae | Fagonia taeckholmiana | Ref. |
|
|
zoom in
| Organism | Sedum album | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Neelakantam,Proc.Indian Acad.Sco.,Sect.A.,5,(1937),357
Harborne,Phytochem.,8,(1969),177 |
|---|
|