| Name |
Salicylic acid 2-Carboxyphenol Saligel Salonil o-Hydroxybenzoic acid |
| Formula |
C7H6O3 |
| Mw |
138.03169406 |
| CAS RN |
69-72-7 |
| C_ID |
C00000206
, 
|
| InChIKey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
| SMILES |
O=C(O)c1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
| Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araceae | Sauromatum guttatum | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Colchicaceae | Burchardia multiflora | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Ericaceae | Gaultheria procumbens  | Ref. |
| Plantae | Ericaceae | Gaultheria yunnanensis | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juglandaceae | Pterocarya stenoptera | Ref. |
| Plantae | Labiatae | Callicarpa integerrima | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Malva silvestris  | Ref. |
| Plantae | Menispermaceae | Menispermum dauricum  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Pinaceae | Abies alba Mill.  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga foetida  | Ref. |
| Plantae | Rosaceae | Mespilus germanica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
| Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
| Plantae | Salicaceae | Populus pseudosimonii | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Salix daphnoides | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|