| Name |
Chrysin 5,7-Dihydroxyflavone 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
480-40-0 |
| C_ID |
C00003794
, 
|
| InChIKey |
RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Asteraceae | Artemisia campestris ssp. glutinosa  | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Flourensia resinosa | Ref. |
| Plantae | Asteraceae | Mikania hirsutissima  | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Chenopodiaceae | Chenopodium graveolens | Ref. |
| Plantae | Cistaceae | Cistus populifolius | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Acacia constricta | Ref. |
| Plantae | Fabaceae | Acacia neovernicosa | Ref. |
| Plantae | Fabaceae | Ononis vaginalis | Ref. |
| Plantae | Fabaceae | Oxytropis pseudoglandulosa | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
| Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria discolor  | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Scutellaria orientalis  | Ref. |
| Plantae | Labiatae | Scutellaria strigillosa | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Orchidaceae | Cypripedium macranthos var. rebunense | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea  | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Phrymaceae | Mimulus moschatus | Ref. |
| Plantae | Pinaceae | Pinus aristata | Ref. |
| Plantae | Pinaceae | Pinus excelsa  | Ref. |
| Plantae | Pinaceae | Pinus monticola | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Primulaceae | Primula farinose | Ref. |
| Plantae | Pteridaceae | Cheilanthes kaulfussii | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rubiaceae | Adina cordifolia Roxb.  | Ref. |
| Plantae | Salicaceae | Populus alba  | Ref. |
| Plantae | Salicaceae | Populus alba var.pyramdalis  | Ref. |
| Plantae | Salicaceae | Populus bejingensis | Ref. |
| Plantae | Salicaceae | Populus canadensis | Ref. |
| Plantae | Salicaceae | Populus davidiana | Ref. |
| Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus tomentosa | Ref. |
| Plantae | Salicaceae | Populus xiaohei | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Ulmaceae | Ulmus sieboldiana | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
|
|
zoom in
| Organism | Pinus excelsa | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Calixto, et al., Planta Med, 69, (2003), 973.
Huang, The Pharmacology of Chinese Herbs, Second Edition, CRC Press Boka Raton, London, New York, Washington D.C., (1999).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Chi, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 31, (1996), 264. |
|---|
|