| Name |
Rhamnetin 3,5,3',4'-Tetrahydroxy-7-methoxyflavone 7-Methoxyquercetin 2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1- benzopyran-4-one 7-O-Methxyl quercetin Rhamnose |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
90-19-7 |
| C_ID |
C00004634
, 
|
| InChIKey |
JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Anthemis altissima  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia campestris ssp. glutinosa  | Ref. |
| Plantae | Asteraceae | Artemisia glutinosa | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Blumea balsamifera  | Ref. |
| Plantae | Asteraceae | Cassinia vauvilliersii | Ref. |
| Plantae | Asteraceae | Centaurea collina L. | Ref. |
| Plantae | Asteraceae | Chromolaena meridensis | Ref. |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Flourensia thurifera | Ref. |
| Plantae | Asteraceae | Madia elegans | Ref. |
| Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Capparaceae | Capparis tweediana  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Cruciferae | Erysimum carniolicum | Ref. |
| Plantae | Dilleniaceae | Dillenia spp. | Ref. |
| Plantae | Dilleniaceae | Tetracera asiatica  | Ref. |
| Plantae | Dilleniaceae | Tetracera spp. | Ref. |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Acacia ixiophylla | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Labiatae | Meehania urticifolia | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa pterygosperma  | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus obliqua  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Polygonaceae | Polygonum amphibium | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Polygonaceae | Polygonum convolvulus  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
| Plantae | Polygonaceae | Polygonum mite | Ref. |
| Plantae | Polygonaceae | Polygonum persicaria  | Ref. |
| Plantae | Rhamnaceae | Rhamnus alaternus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus cathartica  | Ref. |
| Plantae | Rhamnaceae | Rhamnus catharticus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rhamnaceae | Rhamnus saxatilis | Ref. |
| Plantae | Salicaceae | Populus nigra  | Ref. |
| Plantae | Santalaceae | Viscum album  | Ref. |
| Plantae | Santalaceae | Viscum cruciatum  | Ref. |
| Plantae | Smilacaceae | Smilax riparia | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Velloziaceae | Vellozia streptophylla | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
|
|
zoom in
| Organism | Polygonum hydropiper | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|