| Name |
Pluridone |
| Formula |
C12H12O3S |
| Mw |
236.05071498 |
| CAS RN |
88640-29-3 |
| C_ID |
C00064603
|
| InChIKey |
WRFFQUBVIPIZSS-BQYQJAHWSA-N |
| InChICode |
InChI=1S/C12H12O3S/c1-16-12(14)7-8-15-9-11(13)10-5-3-2-4-6-10/h2-8H,9H2,1H3/b8-7+ |
| SMILES |
CSC(=O)C=COCC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe pluridens | Ref. |
|
|
zoom in
| Organism | Aloe pluridens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|