| Name |
Aloechrysone |
| Formula |
C16H16O4 |
| Mw |
272.104859 |
| CAS RN |
141361-37-7 |
| C_ID |
C00063849
|
| InChIKey |
LVSOUEJUPADCBE-MRXNPFEDSA-N |
| InChICode |
InChI=1S/C16H16O4/c1-16(19)7-10-6-9-4-3-5-12(20-2)14(9)15(18)13(10)11(17)8-16/h3-6,18-19H,7-8H2,1-2H3/t16-/m1/s1 |
| SMILES |
COc1cccc2cc3c(c(O)c12)C(=O)CC(C)(O)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe berhana | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe pulcherrima | Ref. |
| Plantae | Asphodelaceae | Aloe rivae | Ref. |
|
|
zoom in
| Organism | Aloe rivae |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
