| Name |
Aloinoside Aloinoside B |
| Formula |
C27H32O13 |
| Mw |
564.18429111 |
| CAS RN |
11006-91-0 |
| C_ID |
C00054569
|
| InChIKey |
BUPDVJFRVYWYEV-SGAFVUFDSA-N |
| InChICode |
InChI=1S/C27H32O13/c1-9-19(31)22(34)25(37)27(39-9)38-8-10-5-12-16(26-24(36)23(35)20(32)15(7-28)40-26)11-3-2-4-13(29)17(11)21(33)18(12)14(30)6-10/h2-6,9,15-16,19-20,22-32,34-37H,7-8H2,1H3/t9-,15+,16+,19-,20+,22+,23-,24+,25+,26-,27+/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](OCc2cc(O)c3c(c2)[C@H]([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2cccc(O)c2C3=O)[C@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe berhana | Ref. |
| Plantae | Asphodelaceae | Aloe cf. perryi | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe pulcherrima  | Ref. |
| Plantae | Asphodelaceae | Aloe rivae | Ref. |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
|
|
zoom in
| Organism | Aloe pulcherrima | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|