| Name |
(+-)-Tetrahydropalmatine Tetrahydropalmatine (+/-)-Tetrahydropalmatine dl-Tetrahydropalmatine (S)-Tetrahydropalmatine |
| Formula |
C21H25NO4 |
| Mw |
355.17835829 |
| CAS RN |
2934-97-6 |
| C_ID |
C00026150
, 
|
| InChIKey |
AEQDJSLRWYMAQI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m1/s1 |
| SMILES |
COc1cc2c(cc1OC)C1Cc3ccc(OC)c(OC)c3CN1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimolia | Ref. |
| Plantae | Annonaceae | Enantia chlorantha  | Ref. |
| Plantae | Berberidaceae | Leontice leontopetalum Linn.  | Ref. |
| Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
| Plantae | Fumariaceae | Corydalis ambigua  | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis decumbens  | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis ochroleuca | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Fumariaceae | Corydalis racemosa | Ref. |
| Plantae | Fumariaceae | Corydalis remota | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis turtschaninowii | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Fumaria bastardii | Ref. |
| Plantae | Menispermaceae | Chasmanthera dependens Hochst.  | Ref. |
| Plantae | Menispermaceae | Fibraurea chloroleuca Miers | Ref. |
| Plantae | Menispermaceae | Fibraurea tinctoria Lour. | Ref. |
| Plantae | Menispermaceae | Hyperbaena columbica (Eichl.) Miers | Ref. |
| Plantae | Menispermaceae | Stephania bancroftii Bailey | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra Diels | Ref. |
| Plantae | Menispermaceae | Stephania delavayi Diels | Ref. |
| Plantae | Menispermaceae | Stephania dicentrinifera H.S.Lo & M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania dielsiana Wu | Ref. |
| Plantae | Menispermaceae | Stephania discflora Hand.-Mazz. | Ref. |
| Plantae | Menispermaceae | Stephania dolichopoda Diels | Ref. |
| Plantae | Menispermaceae | Stephania epigaea H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania glabra (Roxb.) Miers  | Ref. |
| Plantae | Menispermaceae | Stephania kuinanensis H.S.Lo & M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania kwangsiensis H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania lincangensis | Ref. |
| Plantae | Menispermaceae | Stephania macrantha | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Stephania rotunda  | Ref. |
| Plantae | Menispermaceae | Stephania sinica | Ref. |
| Plantae | Menispermaceae | Stephania yunnanensis | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron chinense var.glabriusculum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum taediosum | Ref. |
| - | - | Gloucium vitellinum Boiss and Buhse | Ref. |
| - | - | Stephanina aculeata | Ref. |
| - | - | Stephanina bancroftii | Ref. |
| - | - | Stephanina officinarum | Ref. |
|
|
zoom in
| Organism | Corydalis ambigua | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|