| Name |
3alpha-Dihydrocadambine |
| Formula |
C27H34N2O10 |
| Mw |
546.22134532 |
| CAS RN |
54483-84-0 |
| C_ID |
C00025141
, 
|
| InChIKey |
HNZGKRAKJFZQAY-XRGZMTHUNA-N |
| InChICode |
InChI=1S/C27H34N2O10/c1-36-25(35)15-11-37-26(39-27-24(34)23(33)22(32)19(10-30)38-27)20-14(15)8-17-21-13(6-7-29(17)9-18(20)31)12-4-2-3-5-16(12)28-21/h2-5,11,14,17-20,22-24,26-28,30-34H,6-10H2,1H3/t14-,17+,18-,19+,20+,22-,23+,24+,26+,27+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@@H]2[C@H](O)CN3CCc4c([nH]c5ccccc45)C3C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Anthocephalus cadamba  | Ref. |
| Plantae | Rubiaceae | Anthocephalus chinensis (Lamk.)  | Ref. |
| Plantae | Rubiaceae | Nauclea cadamba ROXB. | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla Miq.  | Ref. |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
|
|
zoom in
| Organism | Uncaria sinensis | | Reference | Heitzman, et al., Phytochemistry, 66, (2005), 5.
Kang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 762.
Kohda, et al., Chem Pharm Bull, 44, (1996), 352.
Zhong, et al., Acta Botanica Yunnanica(Yunnan Zhiwu Yanjiu), 12, (1990), 453.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|