| Name |
Oxyayanin-B |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
548-74-3 |
| C_ID |
C00004696
, 
|
| InChIKey |
UQBUUCDVKDSHCE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-10-5-4-8(6-9(10)19)17-18(25-3)16(22)13-11(26-17)7-12(24-2)14(20)15(13)21/h4-7,19-21H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(O)c(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia cordifolia | Ref. |
| Plantae | Asteraceae | Pterocaulon purpurascens | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Asteraceae | Stevia cuzcoensis | Ref. |
| Plantae | Fabaceae | Apuleia leiocarpa | Ref. |
| Plantae | Fabaceae | Distemonanthus benthamianus  | Ref. |
|
|
zoom in
| Organism | Apuleia leiocarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
King,J.Chem.Soc.,(1954),4587 |
|---|
|