| Name |
Takakin 5,7,8-Trihydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
51876-19-8 |
| C_ID |
C00003851
, 
|
| InChIKey |
FIYPYRNWAKRRIU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-9-4-2-8(3-5-9)13-7-11(18)14-10(17)6-12(19)15(20)16(14)22-13/h2-7,17,19-20H,1H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(O)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Odixia achlaena | Ref. |
| Plantae | Asteraceae | Odixia angusta | Ref. |
| Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Plantaginaceae | Veronica filiformis | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Takakiaceae | Takakia ceratophylla | Ref. |
| Plantae | Takakiaceae | Takakia lepidozioides | Ref. |
|
|
zoom in
| Organism | Veronica filiformis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Takaido,Yakugaku Zasshi,96,(1976),381
Chari,Phytochem.,20,(1981),1977 |
|---|
|