| Name |
Chrysin 5,7-Dihydroxyflavone 5,7-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
480-40-0 |
| C_ID |
C00003794
, 
|
| InChIKey |
RTIXKCRFFJGDFG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-8,16-17H |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Annonaceae | Anomianthus dulcis  | Ref. |
| Plantae | Asteraceae | Artemisia campestris ssp. glutinosa  | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Flourensia resinosa | Ref. |
| Plantae | Asteraceae | Mikania hirsutissima  | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Bignoniaceae | Pajanelia multijuga | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Chenopodiaceae | Chenopodium graveolens | Ref. |
| Plantae | Cistaceae | Cistus populifolius | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Acacia constricta | Ref. |
| Plantae | Fabaceae | Acacia neovernicosa | Ref. |
| Plantae | Fabaceae | Ononis vaginalis | Ref. |
| Plantae | Fabaceae | Oxytropis pseudoglandulosa | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon sessilifolium | Ref. |
| Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria discolor  | Ref. |
| Plantae | Labiatae | Scutellaria oreophila | Ref. |
| Plantae | Labiatae | Scutellaria orientalis  | Ref. |
| Plantae | Labiatae | Scutellaria strigillosa | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Orchidaceae | Cypripedium macranthos var. rebunense | Ref. |
| Plantae | Passifloraceae | Passiflora caerulea  | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Phrymaceae | Mimulus moschatus | Ref. |
| Plantae | Pinaceae | Pinus aristata | Ref. |
| Plantae | Pinaceae | Pinus excelsa  | Ref. |
| Plantae | Pinaceae | Pinus monticola | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Primulaceae | Primula farinose | Ref. |
| Plantae | Pteridaceae | Cheilanthes kaulfussii | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rubiaceae | Adina cordifolia Roxb.  | Ref. |
| Plantae | Salicaceae | Populus alba  | Ref. |
| Plantae | Salicaceae | Populus alba var.pyramdalis  | Ref. |
| Plantae | Salicaceae | Populus bejingensis | Ref. |
| Plantae | Salicaceae | Populus canadensis | Ref. |
| Plantae | Salicaceae | Populus davidiana | Ref. |
| Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus tomentosa | Ref. |
| Plantae | Salicaceae | Populus xiaohei | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Ulmaceae | Ulmus sieboldiana | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
|
|
zoom in
| Organism | Baccharis viminea | | Reference | Wollenweber,Proceeding of the International Compositae Conference,vol 1,(1994)
Hind,Royal Botanic Gardens,Kew,(1996)
Wollenweber,Naturforsch.,52c,(1997),301
Wollenweber,Naturforsch.,52c,(1997),301 |
|---|
|