| Name |
Cucurbitacin I |
| Formula |
C30H42O7 |
| Mw |
514.2930537 |
| CAS RN |
2222-07-3 |
| C_ID |
C00003689
, 
|
| InChIKey |
NISPVUDLMHQFRQ-BUAHFNFDNA-N |
| InChICode |
InChI=1S/C30H42O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-13,17,19-20,23,31-32,36-37H,10,14-15H2,1-8H3/b12-11+/t17-,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
| SMILES |
CC(C)(O)/C=C/C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C=C(O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Cruciferae | Iberis amara  | Ref. |
| Plantae | Cucurbitaceae | Bryonia alba  | Ref. |
| Plantae | Cucurbitaceae | Bryonia dioica  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Citrullus spp. | Ref. |
| Plantae | Cucurbitaceae | Ecballium elaterium  | Ref. |
| Plantae | Plantaginaceae | Gratiola officinalis  | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|