| Name |
cis-alpha-Santalol alpha-Santalol |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
115-71-9 |
| C_ID |
C00003182
, 
|
| InChIKey |
PDEQKAVEYSOLJX-NVFXPZDQNA-N |
| InChICode |
InChI=1S/C15H24O/c1-10(9-16)5-4-6-14(2)11-7-12-13(8-11)15(12,14)3/h5,11-13,16H,4,6-9H2,1-3H3/b10-5-/t11-,12+,13-,14-,15+/m0/s1 |
| SMILES |
C/C(=C/CCC1(C)C2CC3C(C2)C31C)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Santalaceae | Santalum spicatum | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
|
|
zoom in
| Organism | Magnolia officinalis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|