| Name |
Betavulgarin 2'-Hydroxy-5-methoxy-6,7-methylenedioxyisoflavone |
| Formula |
C17H12O6 |
| Mw |
312.06338812 |
| CAS RN |
51068-94-1 |
| C_ID |
C00002509
, 
|
| InChIKey |
NDVRQFZUJRMKKP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O6/c1-20-17-14-12(6-13-16(17)23-8-22-13)21-7-10(15(14)19)9-4-2-3-5-11(9)18/h2-7,18H,8H2,1H3 |
| SMILES |
COc1c2c(cc3occ(-c4ccccc4O)c(=O)c13)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Dianthus spp. | Ref. |
| Plantae | Caryophyllales | Beta corolliflora | Ref. |
| Plantae | Caryophyllales | Beta lomatogona | Ref. |
| Plantae | Caryophyllales | Beta procumbens | Ref. |
| Plantae | Caryophyllales | Beta trigyna | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Dalbergia spp. | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
| Plantae | Iridaceae | Iris tenuifolia | Ref. |
| Plantae | Rosaceae | Cotoneaster pannosa | Ref. |
| - | - | Cercospora beticola | Ref. |
|
|
zoom in
| Organism | Beta trigyna | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Richardson,Biochem.Syst.Ecol.,9,(1981),105
Geigert,Tetrahedron,29,(1973),2703 |
|---|
|