| Name |
Decursinol |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
23458-02-8 |
| C_ID |
C00002466
, 
|
| InChIKey |
BGXFQDFSVDZUIW-STGVRZAANA-N |
| InChICode |
InChI=1S/C14H14O4/c1-14(2)12(15)6-9-5-8-3-4-13(16)17-10(8)7-11(9)18-14/h3-5,7,12,15H,6H2,1-2H3/t12-/m0/s1 |
| SMILES |
CC1(C)Oc2cc3oc(=O)ccc3cc2C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica decursiva  | Ref. |
| Plantae | Apiaceae | Angelica gigas | Ref. |
| Plantae | Apiaceae | Seseli grandivittatum | Ref. |
| Plantae | Apiaceae | Seseli tortuosum LBS.Eur. | Ref. |
| Plantae | Rutaceae | Aegle marmelos | Ref. |
|
|
zoom in
| Organism | Aegle marmelos |
|---|
| Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
