| Name |
Salicylic acid 2-Carboxyphenol Saligel Salonil o-Hydroxybenzoic acid |
| Formula |
C7H6O3 |
| Mw |
138.03169406 |
| CAS RN |
69-72-7 |
| C_ID |
C00000206
, 
|
| InChIKey |
YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
| SMILES |
O=C(O)c1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
| Plantae | Anacardiaceae | Anacardium occidentale  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araceae | Sauromatum guttatum | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Colchicaceae | Burchardia multiflora | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Ericaceae | Gaultheria procumbens  | Ref. |
| Plantae | Ericaceae | Gaultheria yunnanensis | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juglandaceae | Pterocarya stenoptera | Ref. |
| Plantae | Labiatae | Callicarpa integerrima | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Malva silvestris  | Ref. |
| Plantae | Menispermaceae | Menispermum dauricum  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Pinaceae | Abies alba Mill.  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga foetida  | Ref. |
| Plantae | Rosaceae | Mespilus germanica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
| Plantae | Salicaceae | Populus pseudo-simonii | Ref. |
| Plantae | Salicaceae | Populus pseudosimonii | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Plantago major | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zhang, et al., Phytochemistry, 65, (2004), 929.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|