| Name |
Kaempferol 3,7-dimethyl ether Kumatakenin Kumatakillin 5,4'-Dihydroxy-3,7-dimethoxyflavone Jaranol Kaempferol 3,7-O-dimethyl ether 5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
3301-49-3 |
| C_ID |
C00004569
, 
|
| InChIKey |
BJBUTJQYZDYRMJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-11-7-12(19)14-13(8-11)23-16(17(22-2)15(14)20)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)cc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea ageratum  | Ref. |
| Plantae | Asteraceae | Flourensia retinophylla | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Boraginaceae | Heliotropium chenopodiaceum var. ericoideum | Ref. |
| Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Calceolariaceae | Calceolaria arachnoidea | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum L.  | Ref. |
| Plantae | Geraniaceae | Pelargonium fulgidum  | Ref. |
| Plantae | Labiatae | Salvia cyanescens | Ref. |
| Plantae | Labiatae | Salvia glutinosa  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L.  | Ref. |
| Plantae | Rutaceae | Bosistoa brassii | Ref. |
| Plantae | Rutaceae | Evodia merrillii | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Santalaceae | Viscum album  | Ref. |
| Plantae | Santalaceae | Viscum cruciatum  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Chamaesaracha sordida | Ref. |
| Plantae | Solanaceae | Solanum paludosum  | Ref. |
| Plantae | Zingiberaceae | Alpinia japonica | Ref. |
| Plantae | Zingiberaceae | Alpinia kumatake | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Microtonea prainiana | Ref. |
|
|
zoom in
| Organism | Microtonea prainiana | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Li, et al., Journal of Natural Products, 67, (2004), 978 |
|---|
|