| Name |
Galangin Norizalpinin 3,5,7-Trihydroxyflavone 3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
548-83-4 |
| C_ID |
C00004533
, 
|
| InChIKey |
VCCRNZQBSJXYJD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
| SMILES |
O=c1c(O)c(-c2ccccc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Cassinia quinquefaria | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Asteraceae | Helichrysum aureonitens | Ref. |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Heterothalamus psiadioides | Ref. |
| Plantae | Asteraceae | Odixia spp. | Ref. |
| Plantae | Betulaceae | Alnus pendula | Ref. |
| Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
| Plantae | Datiscaceae | Datisca cannabina  | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Millettia racemosa  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Grossulariaceae | Ribes viscosissimum  | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum pampaninii | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria galericulata  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Salicaceae | Populus nigra  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga  | Ref. |
| Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber mioga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|