| Name |
Geranyl acetate Acetic acid geraniol ester trans-Geranyl acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
105-87-3 |
| C_ID |
C00003046
, 
|
| InChIKey |
HIGQPQRQIQDZMP-DHZHZOJOSA-N |
| InChICode |
InChI=1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ |
| SMILES |
CC(=O)OC/C=C(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Asteraceae | Conyza newii  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Tanacetum longifolium | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Geraniaceae | Pelargonium odoratissimum  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Mentha piperita L.  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Myrtaceae | Eucalyptus macarthurii | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Cymbopogon martinii  | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K33-81)  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus latifolia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Rutaceae | Citrus vulgaris  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|