| Name |
(-)-Jasmonic acid Jasmonic acid trans-Jasmonic acid 3-Oxo-2-(2Z-pentenyl)cyclotentylacetic acid |
| Formula |
C12H18O3 |
| Mw |
210.12559444 |
| CAS RN |
6894-38-8 |
| C_ID |
C00000218
, 
|
| InChIKey |
ZNJFBWYDHIGLCU-AVDNRZGUNA-N |
| InChICode |
InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1 |
| SMILES |
CC/C=CC[C@H]1C(=O)CC[C@@H]1CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Excavata | Euglenaceae | Euglena gracilis | Ref. |
| Fungi | Botryosphaeriaceae | Lasiodiplodia theobromae IFO 31059 | Ref. |
| Fungi | Incertae sedis | Botryodiplodia theobromae | Ref. |
| Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Rauvolfia canescens | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Helianthus tuberosus  | Ref. |
| Plantae | Chlorellaceae | Chlorella sp. | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita maxima  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Fabaceae | Calliandra haematocephala | Ref. |
| Plantae | Fabaceae | Dolichos lablab  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Mimosa pudica  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vicia narbonensis  | Ref. |
| Plantae | Fagaceae | Castanea crenata  | Ref. |
| Plantae | Fagaceae | Fagus sylvatica  | Ref. |
| Plantae | Fagaceae | Quercus robur  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Malvaceae | Malva sylvestris  | Ref. |
| Plantae | Moraceae | Ficus superba | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Poaceae | Oryza officinalis | Ref. |
| Plantae | Poaceae | Secale cereale  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Solanaceae | Solanum demissum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Theaceae | Camellia japonica  | Ref. |
| Plantae | Theaceae | Camellia sasanqua  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Cleyera ochnacea | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Yang, et al., Phytochemistry, 54, (2000), 489 |
|---|
|