| Name |
Acacetin 5,7-Dihydroxy-4'-methoxyflavone Apigenin 4'-methyl ether |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
480-44-4 |
| C_ID |
C00003820
, 
|
| InChIKey |
DANYIYRPLHHOCZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-8,17-18H,1H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Asteraceae | Chrysanthemum leucanthemum | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Asteraceae | Eupatorium tinifolium | Ref. |
| Plantae | Betulaceae | Ostrya japonica | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Indigofera tetrantha | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Crocus aureus | Ref. |
| Plantae | Iridaceae | Crocus heuffelianus | Ref. |
| Plantae | Iridaceae | Crocus laevigatus | Ref. |
| Plantae | Labiatae | Callicarpa pilosissima | Ref. |
| Plantae | Labiatae | Leucas aspera  | Ref. |
| Plantae | Labiatae | Mentha aquatica  | Ref. |
| Plantae | Labiatae | Mentha longifolia  | Ref. |
| Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton  | Ref. |
| Plantae | Labiatae | Ocimum basilicum L.  | Ref. |
| Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia yosgadensis | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L.  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Stilbaceae | Nuxia sphaerocephala  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana chionophila | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana fedtschenkoi | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spryginii | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
|
|
zoom in
| Organism | Origanum micranthum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|