| Name |
l-Scoulerine Scoulerine (-)-Scoulerine (S)-Scoulerine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
6451-73-6 |
| C_ID |
C00026092
, 
|
| InChIKey |
KNWVMRVOBAFFMH-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@@H]1Cc3ccc(OC)c(O)c3CN1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Disepalum pulchrum | Ref. |
| Plantae | Berberidaceae | Berberis aquifolium | Ref. |
| Plantae | Berberidaceae | Berberis aristata  | Ref. |
| Plantae | Berberidaceae | Berberis thunbergii  | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Berberis wilsoniae | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
| Plantae | Fabaceae | Erythrina orientalis Murr. | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis caseana A.Gray. | Ref. |
| Plantae | Fumariaceae | Corydalis caucasia | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey. | Ref. |
| Plantae | Fumariaceae | Corydalis hsuchowensis | Ref. |
| Plantae | Fumariaceae | Corydalis incisa | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis majori | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Fumariaceae | Corydalis pseudoadunca | Ref. |
| Plantae | Fumariaceae | Corydalis sibirica Pers. | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis stewartii | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
| Plantae | Fumariaceae | Fumaria asepala  | Ref. |
| Plantae | Fumariaceae | Fumaria bella | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria cilicica | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria judaica | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Hypecoum procumbens L. | Ref. |
| Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
| Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
| Plantae | Lauraceae | Cryptocarya longifolia Kostermans | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Hunnemannia fumariaefolia Sweet | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
| Plantae | Papaveraceae | Papaver albiflora | Ref. |
| Plantae | Papaveraceae | Papaver albiflorum (sub.spp.albiflorum austromoravicum) | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Papaveraceae | Papaver confine | Ref. |
| Plantae | Papaveraceae | Papaver lecoquii Lamotte | Ref. |
| Plantae | Papaveraceae | Papaver orientale  | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas chelidonides  | Ref. |
| Plantae | Papaveraceae | Papaver setigerum | Ref. |
| Plantae | Papaveraceae | Papaver somniferum L.  | Ref. |
| Plantae | Papaveraceae | Papaver stevenianum | Ref. |
| Plantae | Papaveraceae | Papaver tauricola | Ref. |
| Plantae | Papaveraceae | Papaver trinifolium | Ref. |
| Plantae | Papaveraceae | Papaver triniifolium | Ref. |
| Plantae | Papaveraceae | Stylophorum lasiocarpum | Ref. |
| Plantae | Ranunculaceae | Coptis japonica  | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
| Plantae | Rutaceae | Phellodendron chinensis | Ref. |
| Plantae | Rutaceae | Zanthoxylum taediosum | Ref. |
| - | - | Fumaris vaillantii Loisel. | Ref. |
| - | - | Mohonia bealei | Ref. |
|
|
zoom in
| Organism | Fumaria judaica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|