| Name |
Nataloin |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
1400-57-3 |
| C_ID |
C00063843
|
| InChIKey |
PCPHLXZWNQEQRB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O9/c1-7-4-9-13(21-20(29)19(28)17(26)12(6-22)30-21)8-2-3-10(23)16(25)15(8)18(27)14(9)11(24)5-7/h2-5,12-13,17,19-26,28-29H,6H2,1H3 |
| SMILES |
Cc1cc(O)c2c(c1)C(C1OC(CO)C(O)C(O)C1O)c1ccc(O)c(O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe berhana | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe pulcherrima | Ref. |
| Plantae | Asphodelaceae | Aloe rivae | Ref. |
|
|
zoom in
| Organism | Aloe pulcherrima |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
