| Name |
Sennoside B |
| Formula |
C42H38O20 |
| Mw |
862.19564366 |
| CAS RN |
128-57-4 |
| C_ID |
C00063759
|
| InChIKey |
IPQVTOJGNYVQEO-AIFLABODSA-N |
| InChICode |
InChI=1S/C42H38O20/c43-11-23-31(47)35(51)37(53)41(61-23)59-21-5-1-3-15-25(17-7-13(39(55)56)9-19(45)27(17)33(49)29(15)21)26-16-4-2-6-22(60-42-38(54)36(52)32(48)24(12-44)62-42)30(16)34(50)28-18(26)8-14(40(57)58)10-20(28)46/h1-10,23-26,31-32,35-38,41-48,51-54H,11-12H2,(H,55,56)(H,57,58)/t23-,24-,25-,26+,31-,32-,35+,36+,37-,38-,41-,42-/m1/s1 |
| SMILES |
O=C(O)c1cc(O)c2c(c1)C(C1c3cc(C(=O)O)cc(O)c3C(=O)c3c(OC4OC(CO)C(O)C(O)C4O)cccc31)c1cccc(OC3OC(CO)C(O)C(O)C3O)c1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Rumex acetosa  | Ref. |
| Plantae | Polygonaceae | Rumex acetosella  | Ref. |
| Plantae | Polygonaceae | Rumex confertus  | Ref. |
| Plantae | Polygonaceae | Rumex crispus  | Ref. |
| Plantae | Polygonaceae | Rumex hydrolapathum | Ref. |
| Plantae | Polygonaceae | Rumex obtusifolius  | Ref. |
|
|
zoom in
| Organism | Rumex crispus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|