| Name |
2-Pentanone FEMA 2842 |
| Formula |
C5H10O |
| Mw |
86.07316494 |
| CAS RN |
107-87-9 |
| C_ID |
C00052133
|
| InChIKey |
XNLICIUVMPYHGG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
| SMILES |
CCCC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Eupatorium adenophorum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|