| Name |
Aloeresin E (-)-Aloeresin E (Aloe peglerae) |
| Formula |
C34H38O16 |
| Mw |
702.21598517 |
| CAS RN |
182754-64-9 |
| C_ID |
C00042218
, 
|
| InChIKey |
QOGNEZKTQHDWEZ-WVGUNDSXNA-N |
| InChICode |
InChI=1S/C34H38O15/c1-15-10-20(47-34-30(44)28(42)26(40)22(14-36)48-34)25(31-24(15)19(38)12-18(45-31)11-16(2)37)32-33(29(43)27(41)21(13-35)46-32)49-23(39)9-8-17-6-4-3-5-7-17/h3-10,12,21-22,26-30,32-36,40-44H,11,13-14H2,1-2H3/b9-8+/t21-,22-,26+,27+,28+,29+,30-,32+,33-,34-/m1/s1 |
| SMILES |
CC(=O)Cc1cc(=O)c2c(C)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3OC(=O)/C=C/c3ccccc3)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe arborescens  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe peglerae | Ref. |
| Plantae | Asphodelaceae | Aloe striata | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
|
|
zoom in
| Organism | Aloe peglerae | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|