| Name |
omega-Hydroxyemodin Citreorosein |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
481-73-2 |
| C_ID |
C00032090
, 
|
| InChIKey |
YQHZABGPIPECSQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2 |
| SMILES |
O=C1c2cc(O)cc(O)c2C(=O)c2c(O)cc(CO)cc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Lasiosphaeriaceae | Zopfiella longicaudata | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Polygonaceae | Rumex aquaticus  | Ref. |
|
|
zoom in
| Organism | Rumex aquaticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|