| Name |
gamma-Curcumene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
28976-68-3 |
| C_ID |
C00030346
, 
|
| InChIKey |
NGIVKZGKEPRIGG-YQTOOIBONA-N |
| InChICode |
InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14H,5,7,9,11H2,1-4H3/t14-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)C1=CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Santalaceae | Osyris tenuifolia | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Eupatorium adenophorum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|