| Name |
Candidine Qingdainone Qingdainone |
| Formula |
C23H13N3O2 |
| Mw |
363.10077668 |
| CAS RN |
97457-31-3 |
| C_ID |
C00026237
, 
|
| InChIKey |
DXENDDMPDZMHSQ-FMQUCBEESA-N |
| InChICode |
InChI=1S/C23H13N3O2/c27-21-13-7-1-4-10-16(13)24-20(21)19-15-9-3-6-12-18(15)26-22(19)25-17-11-5-2-8-14(17)23(26)28/h1-12,24H/b20-19+ |
| SMILES |
O=C1/C(=c2/c3ccccc3n3c(=O)c4ccccc4nc23)Nc2ccccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Ala IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Saccharomycetaceae | Candida lipolitica | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Polygonaceae | Polygonum tinctorium | Ref. |
| - | - | Baphicacanthus cusia  | Ref. |
|
|
zoom in
| Organism | Baphicacanthus cusia | | Reference | Zou, et al., APS, 20, (1985), 45.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|