| Name |
Penniclavine |
| Formula |
C16H18N2O2 |
| Mw |
270.13682783 |
| CAS RN |
519-13-1 |
| C_ID |
C00011220
, 
|
| InChIKey |
KCHBNRCSCHMJFD-AQPSWHTGNA-N |
| InChICode |
InChI=1S/C16H18N2O2/c1-18-8-16(20,9-19)6-12-11-3-2-4-13-15(11)10(7-17-13)5-14(12)18/h2-4,6-7,14,17,19-20H,5,8-9H2,1H3/t14-,16+/m1/s1 |
| SMILES |
CN1C[C@](O)(CO)C=C2c3cccc4[nH]cc(c34)C[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Ala IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Claviceps purpurea  | Ref. |
| Plantae | Convolvulaceae | Argyreia nervosa  | Ref. |
| Plantae | Convolvulaceae | Ipomoea hederacea  | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Poaceae | Pennisetum typhoideum  | Ref. |
| Plantae | Ranunculaceae | Aconitum pendulum | Ref. |
|
|
zoom in
| Organism | Pharbitis nil | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|