| Name |
2-Prenyl-6a-hydroxyphaseollidin 3,6a,9-Trihydroxy-2,10-diprenylpterocarpan |
| Formula |
C25H28O5 |
| Mw |
408.193674 |
| CAS RN |
104363-19-1 |
| C_ID |
C00010024
, 
|
| InChIKey |
ZAAKSBRPXNODLV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O5/c1-14(2)5-7-16-11-18-22(12-21(16)27)29-13-25(28)19-9-10-20(26)17(8-6-15(3)4)23(19)30-24(18)25/h5-6,9-12,24,26-28H,7-8,13H2,1-4H3/t24-,25+/m1/s1 |
| SMILES |
CC(C)=CCc1cc2c(cc1O)OCC1(O)c3ccc(O)c(CC=C(C)C)c3OC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
|
|
zoom in
| Organism | Phaseolus lunatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
O'Neil,Phytochem.,25,(1986),1315 |
|---|
|