| Name |
Euchrenone b10 8-Prenylerythrinin C |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
130289-28-0 |
| C_ID |
C00009950
, 
|
| InChIKey |
LKFQSODZCVNSSG-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-10-16-23-17(11-19(31-23)25(3,4)29)21(27)20-22(28)18(12-30-24(16)20)14-6-8-15(26)9-7-14/h5-9,12,19,26-27,29H,10-11H2,1-4H3/t19-/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c(-c4ccc(O)cc4)coc13)CC(C(C)(C)O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina variegata L.  | Ref. |
| Plantae | Fabaceae | Euchresta horsfeldii | Ref. |
| Plantae | Fabaceae | Euchresta japonica  | Ref. |
|
|
zoom in
| Organism | Euchresta horsfeldii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Mizuno,Phytochem.,29,(1990),2663 |
|---|
|