| Name |
Procyanidin C1 [Epicatechin-(4beta->8)]2-epicatechin |
| Formula |
C45H38O18 |
| Mw |
866.20581441 |
| CAS RN |
65085-09-8 |
| C_ID |
C00009098
, 
|
| InChIKey |
MOJZMWJRUKIQGL-UZWUUNAJNA-N |
| InChICode |
InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2/t31-,37-,38-,39-,40-,41+,42-,43-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Nelia meyeri | Ref. |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Dioscoreaceae | Dioscorea cirrhosa | Ref. |
| Plantae | Fabaceae | Campylotropis hirella | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia Blume.  | Ref. |
| Plantae | Lauraceae | Cinnamomum comphora | Ref. |
| Plantae | Lauraceae | Cinnamomum obtusifolium Nees. | Ref. |
| Plantae | Lauraceae | Cinnamomum zeylanicum  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
| Plantae | Rubiaceae | Cinchona succirubra  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Campylotropis hirella | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Hsu, et al., Chem Pharm Bull, 33, (1985), 3293.
Morimoto, et al., Chem Pharm Bull, 34, (1986), 633.
Qin, et al., Chem Abstr, 116, (1992), 21112x |
|---|
|