| Name |
Aureusidin |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
480-70-6 |
| C_ID |
C00008027
, 
|
| InChIKey |
WBEFUVAYFSOUEA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-5-11(19)14-12(6-8)21-13(15(14)20)4-7-1-2-9(17)10(18)3-7/h1-6,16-19H/b13-4+ |
| SMILES |
O=C1C(=Cc2ccc(O)c(O)c2)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Melanorrhoea aptera | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus  | Ref. |
| Plantae | Cyperaceae | Eleocharis acuta | Ref. |
| Plantae | Cyperaceae | Gahnia clarkei | Ref. |
| Plantae | Cyperaceae | Lepironia articulata  | Ref. |
| Plantae | Cyperaceae | Ptilanthelium deustum | Ref. |
| Plantae | Cyperaceae | Remirea maritima | Ref. |
| Plantae | Cyperaceae | Schoenus apogon | Ref. |
| Plantae | Cyperaceae | Scirpus nodosus | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Plumbaginaceae | Limonium spp. | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Gahnia clarkei | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Geissman,Arch.Biochem.Biophys.,49,(1954),368
Clifford,Phytochem.,8,(1969),123 |
|---|
|