| Name |
(-)-Sophoridine Sophoridine |
| Formula |
C15H24N2O |
| Mw |
248.1888634 |
| CAS RN |
6882-68-4 |
| C_ID |
C00007757
, 
|
| InChIKey |
ZSBXGIUJOOQZMP-SFJKVIHPNA-N |
| InChICode |
InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12-,13-,15+/m1/s1 |
| SMILES |
O=C1CCC[C@@H]2[C@H]3CCCN4CCC[C@H](CN12)[C@@H]34 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Sophora alopecuroides | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora viciifolia | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| - | - | Leptorhabdos parviflora | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|