| Name |
Kaempferol 3-xyloside |
| Formula |
C20H18O10 |
| Mw |
418.0899968 |
| CAS RN |
60933-78-0 |
| C_ID |
C00005134
, 
|
| InChIKey |
RNVUDWOQYYWXBJ-LJDZMODXNA-N |
| InChICode |
InChI=1S/C20H18O10/c21-9-3-1-8(2-4-9)18-19(30-20-17(27)15(25)12(24)7-28-20)16(26)14-11(23)5-10(22)6-13(14)29-18/h1-6,12,15,17,20-25,27H,7H2/t12-,15-,17+,20-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Clibadium arboreum | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Astragalus spp. | Ref. |
| Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
| Plantae | Saxifragaceae | Heuchera villosa | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
|
|
zoom in
| Organism | Heuchera micrantha | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Miller,Phytochem.,18,(1979),1412 |
|---|
|