| Name |
Axillarin 3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone Quercetagetin 3,6-dimethyl ether 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
5188-73-8 |
| C_ID |
C00004684
, 
|
| InChIKey |
KIGVXRGRNLQNNI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia chamissonis | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia australis | Ref. |
| Plantae | Asteraceae | Asteriscus sericeus | Ref. |
| Plantae | Asteraceae | Bahia pringlei | Ref. |
| Plantae | Asteraceae | Calycadenia spp. | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
| Plantae | Asteraceae | Eriophyllum staechadifolium | Ref. |
| Plantae | Asteraceae | Flourensia hirsuta | Ref. |
| Plantae | Asteraceae | Gonospermum elegans | Ref. |
| Plantae | Asteraceae | Gonospermum gomerae | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Holocarpha heermannii | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Inula germanica  | Ref. |
| Plantae | Asteraceae | Iva axillaris | Ref. |
| Plantae | Asteraceae | Iva hayesiana | Ref. |
| Plantae | Asteraceae | Madia sativa  | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Asteraceae | Tanacetum balsamita  | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Asteraceae | Tanacetum vulgare  | Ref. |
| Plantae | Asteraceae | Xanthium pensylvanicum | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Didiereaceae | Didierea spp. | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Rutaceae | Dictamnus albus  | Ref. |
|
|
zoom in
| Organism | Artemisia annua | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|