| Name |
5,6,4'-Trihydroxy-3,7-dimethoxyflavone 6-Hydroxykaempferol 3,7-dimethyl ether 5,6-Dihydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
56226-95-0 |
| C_ID |
C00004597
, 
|
| InChIKey |
QXSBUADZOSXXPZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-11-7-10-12(14(20)13(11)19)15(21)17(23-2)16(24-10)8-3-5-9(18)6-4-8/h3-7,18-20H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)c(OC)c(=O)c2c(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina deltoidea | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Heterotheca inuloides | Ref. |
| Plantae | Asteraceae | Inula spp. | Ref. |
| Plantae | Asteraceae | Parthenium incanum | Ref. |
| Plantae | Asteraceae | Parthenium tomentosum | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Asteraceae | Pulicaria parthenium | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
|
|
zoom in
| Organism | Inula spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Nikonova,Khim.Prir.Soedin.,11(1975),96
Wagner,Tetrahedron Lett.,(1976),67 |
|---|
|