| Name |
Mutatochrome beta-carotene 5,8-epoxide |
| Formula |
C40H56O |
| Mw |
552.43311641 |
| CAS RN |
515-06-0 |
| C_ID |
C00003779
, 
|
| InChIKey |
FSLLIPKSVXRYJI-FZKBJVJCNA-N |
| InChICode |
InChI=1S/C40H56O/c1-30(19-13-20-32(3)24-25-35-33(4)23-15-26-38(35,6)7)17-11-12-18-31(2)21-14-22-34(5)36-29-37-39(8,9)27-16-28-40(37,10)41-36/h11-14,17-22,24-25,29,37H,15-16,23,26-28H2,1-10H3/b12-11+,19-13+,21-14+,25-24+,30-17+,31-18+,32-20+,34-22+/t37-,40+/m1/s1 |
| SMILES |
CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)C2=CC3C(C)(C)CCCC3(C)O2)C(C)(C)CCC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Calendula officinalis L.  | Ref. |
| Plantae | Asteraceae | Calendula spp. | Ref. |
| Plantae | Asteraceae | Chrysanthemum coronarium  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora edulis  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Cyanophyta sp. | Ref. |
| - | - | Oscillatoria agardhii | Ref. |
|
|
zoom in
| Organism | Chrysanthemum coronarium | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter60 |
|---|
|