| Name |
(-)-Medicarpin Medicarpin 3-Hydroxy-9-methoxypterocarpan |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
32383-76-9 |
| C_ID |
C00002547
, 
|
| InChIKey |
NSRJSISNDPOJOP-AYSIPDSENA-N |
| InChICode |
InChI=1S/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m0/s1 |
| SMILES |
COc1ccc2c(c1)O[C@H]1c3ccc(O)cc3OC[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Fabaceae | Camptosema rubicundum | Ref. |
| Plantae | Fabaceae | Canavalia bonariensis | Ref. |
| Plantae | Fabaceae | Canavalia cathartica  | Ref. |
| Plantae | Fabaceae | Canavalia eurycarpa | Ref. |
| Plantae | Fabaceae | Canavalia galeata | Ref. |
| Plantae | Fabaceae | Canavalia gladiata  | Ref. |
| Plantae | Fabaceae | Canavalia rosea  | Ref. |
| Plantae | Fabaceae | Canavalia sericea | Ref. |
| Plantae | Fabaceae | Caragana acanthophylla | Ref. |
| Plantae | Fabaceae | Caragana altaica | Ref. |
| Plantae | Fabaceae | Caragana ambigua  | Ref. |
| Plantae | Fabaceae | Caragana arborescens  | Ref. |
| Plantae | Fabaceae | Caragana aurantiaca | Ref. |
| Plantae | Fabaceae | Caragana boisii | Ref. |
| Plantae | Fabaceae | Caragana brevispina  | Ref. |
| Plantae | Fabaceae | Caragana conferta | Ref. |
| Plantae | Fabaceae | Caragana decorticans | Ref. |
| Plantae | Fabaceae | Caragana densa | Ref. |
| Plantae | Fabaceae | Caragana erinacea | Ref. |
| Plantae | Fabaceae | Caragana franchetiana | Ref. |
| Plantae | Fabaceae | Caragana frutex | Ref. |
| Plantae | Fabaceae | Caragana fruticosa | Ref. |
| Plantae | Fabaceae | Caragana gerardiana | Ref. |
| Plantae | Fabaceae | Caragana grandiflora | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Caragana kirghisorum | Ref. |
| Plantae | Fabaceae | Caragana laeta | Ref. |
| Plantae | Fabaceae | Caragana microphylla  | Ref. |
| Plantae | Fabaceae | Caragana pekinensis | Ref. |
| Plantae | Fabaceae | Caragana pleiophylla | Ref. |
| Plantae | Fabaceae | Caragana pumila | Ref. |
| Plantae | Fabaceae | Caragana pygmaea | Ref. |
| Plantae | Fabaceae | Caragana sinica  | Ref. |
| Plantae | Fabaceae | Caragana sophorifolia | Ref. |
| Plantae | Fabaceae | Caragana spinosa | Ref. |
| Plantae | Fabaceae | Caragana stenophylla  | Ref. |
| Plantae | Fabaceae | Caragana tangutica | Ref. |
| Plantae | Fabaceae | Caragana tibetica | Ref. |
| Plantae | Fabaceae | Caragana tragacanthoides | Ref. |
| Plantae | Fabaceae | Caragana turkestanica | Ref. |
| Plantae | Fabaceae | Caragana ussuriensis | Ref. |
| Plantae | Fabaceae | Carmichaelia flagelliformis | Ref. |
| Plantae | Fabaceae | Centrolobium robustum | Ref. |
| Plantae | Fabaceae | Centrolobium sclerophyllum | Ref. |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer bijugum | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer macracanthum | Ref. |
| Plantae | Fabaceae | Cicer montbretii | Ref. |
| Plantae | Fabaceae | Cicer pungens | Ref. |
| Plantae | Fabaceae | Cicer rechingeri | Ref. |
| Plantae | Fabaceae | Cicer reticulatum | Ref. |
| Plantae | Fabaceae | Cicer songaricum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Dalbergia variabilis | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Galactia jussiaeana | Ref. |
| Plantae | Fabaceae | Galactia striata | Ref. |
| Plantae | Fabaceae | Gliricidia sepium  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lathyrus grandiflorus | Ref. |
| Plantae | Fabaceae | Lathyrus hirsutus | Ref. |
| Plantae | Fabaceae | Lathyrus linifolius | Ref. |
| Plantae | Fabaceae | Lathyrus tuberosus  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago doliata | Ref. |
| Plantae | Fabaceae | Medicago falcata | Ref. |
| Plantae | Fabaceae | Medicago glomerata | Ref. |
| Plantae | Fabaceae | Medicago hypogaea | Ref. |
| Plantae | Fabaceae | Medicago intertexta | Ref. |
| Plantae | Fabaceae | Medicago littoralis | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago minima | Ref. |
| Plantae | Fabaceae | Medicago orbicularis  | Ref. |
| Plantae | Fabaceae | Medicago platycarpa  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago rigidula | Ref. |
| Plantae | Fabaceae | Medicago rugosa L. | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago scutellata  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus altissimus  | Ref. |
| Plantae | Fabaceae | Melilotus dentatus | Ref. |
| Plantae | Fabaceae | Melilotus elegans | Ref. |
| Plantae | Fabaceae | Melilotus indica  | Ref. |
| Plantae | Fabaceae | Melilotus infestus | Ref. |
| Plantae | Fabaceae | Melilotus italica | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Melilotus neapolitanus | Ref. |
| Plantae | Fabaceae | Melilotus polonicus | Ref. |
| Plantae | Fabaceae | Melilotus tauricus | Ref. |
| Plantae | Fabaceae | Melilotus wolgicus | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Mucuna poggei | Ref. |
| Plantae | Fabaceae | Mucuna pruriens  | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Myroxylon peruiferum  | Ref. |
| Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
| Plantae | Fabaceae | Ononis alopecuroides | Ref. |
| Plantae | Fabaceae | Ononis biflora | Ref. |
| Plantae | Fabaceae | Ononis cristata | Ref. |
| Plantae | Fabaceae | Ononis fruticosa | Ref. |
| Plantae | Fabaceae | Ononis hispida | Ref. |
| Plantae | Fabaceae | Ononis minutissima | Ref. |
| Plantae | Fabaceae | Ononis mitissima | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Fabaceae | Ononis oligophylla | Ref. |
| Plantae | Fabaceae | Ononis ornithopodioides | Ref. |
| Plantae | Fabaceae | Ononis pinnata | Ref. |
| Plantae | Fabaceae | Ononis pubescens | Ref. |
| Plantae | Fabaceae | Ononis pusilla | Ref. |
| Plantae | Fabaceae | Ononis reclinata | Ref. |
| Plantae | Fabaceae | Ononis rotundifolia | Ref. |
| Plantae | Fabaceae | Ononis serrata | Ref. |
| Plantae | Fabaceae | Ononis speciosa | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Ononis subspicata | Ref. |
| Plantae | Fabaceae | Ononis variegata | Ref. |
| Plantae | Fabaceae | Ononis viscosa subsp. breviflora  | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis  | Ref. |
| Plantae | Fabaceae | Platymiscium trinitatis | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| Plantae | Fabaceae | Taverniera abyssinica  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
| Plantae | Fabaceae | Trifolium africanum | Ref. |
| Plantae | Fabaceae | Trifolium alexandrinum | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium alpinum  | Ref. |
| Plantae | Fabaceae | Trifolium ambiguum | Ref. |
| Plantae | Fabaceae | Trifolium angulatum | Ref. |
| Plantae | Fabaceae | Trifolium angustifolium  | Ref. |
| Plantae | Fabaceae | Trifolium apertum | Ref. |
| Plantae | Fabaceae | Trifolium bivonae | Ref. |
| Plantae | Fabaceae | Trifolium bocconei | Ref. |
| Plantae | Fabaceae | Trifolium bullatum | Ref. |
| Plantae | Fabaceae | Trifolium burchellianum | Ref. |
| Plantae | Fabaceae | Trifolium canescens | Ref. |
| Plantae | Fabaceae | Trifolium cernuum | Ref. |
| Plantae | Fabaceae | Trifolium cherleri | Ref. |
| Plantae | Fabaceae | Trifolium clusii | Ref. |
| Plantae | Fabaceae | Trifolium clypeatum | Ref. |
| Plantae | Fabaceae | Trifolium congestum | Ref. |
| Plantae | Fabaceae | Trifolium dalmaticum | Ref. |
| Plantae | Fabaceae | Trifolium dasyurum | Ref. |
| Plantae | Fabaceae | Trifolium dichroanthum | Ref. |
| Plantae | Fabaceae | Trifolium diffusum | Ref. |
| Plantae | Fabaceae | Trifolium echinatum | Ref. |
| Plantae | Fabaceae | Trifolium eriosphaerum | Ref. |
| Plantae | Fabaceae | Trifolium fragiferum | Ref. |
| Plantae | Fabaceae | Trifolium fucatum | Ref. |
| Plantae | Fabaceae | Trifolium glanduliferum | Ref. |
| Plantae | Fabaceae | Trifolium globosum | Ref. |
| Plantae | Fabaceae | Trifolium glomeratum | Ref. |
| Plantae | Fabaceae | Trifolium heldreichianum | Ref. |
| Plantae | Fabaceae | Trifolium hirtum | Ref. |
| Plantae | Fabaceae | Trifolium incarnatum | Ref. |
| Plantae | Fabaceae | Trifolium isthmocarpum | Ref. |
| Plantae | Fabaceae | Trifolium lappaceum | Ref. |
| Plantae | Fabaceae | Trifolium ligusticum | Ref. |
| Plantae | Fabaceae | Trifolium lupinaster | Ref. |
| Plantae | Fabaceae | Trifolium masaiense | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium michelianum | Ref. |
| Plantae | Fabaceae | Trifolium miegeanum | Ref. |
| Plantae | Fabaceae | Trifolium montanum | Ref. |
| Plantae | Fabaceae | Trifolium mutabile | Ref. |
| Plantae | Fabaceae | Trifolium nigrescens | Ref. |
| Plantae | Fabaceae | Trifolium noricum | Ref. |
| Plantae | Fabaceae | Trifolium obscurum | Ref. |
| Plantae | Fabaceae | Trifolium ochroleucon | Ref. |
| Plantae | Fabaceae | Trifolium ornithopodioides | Ref. |
| Plantae | Fabaceae | Trifolium palaestinum | Ref. |
| Plantae | Fabaceae | Trifolium pallescens | Ref. |
| Plantae | Fabaceae | Trifolium pallidum | Ref. |
| Plantae | Fabaceae | Trifolium pannonicum  | Ref. |
| Plantae | Fabaceae | Trifolium parnassii | Ref. |
| Plantae | Fabaceae | Trifolium parryi | Ref. |
| Plantae | Fabaceae | Trifolium patulum | Ref. |
| Plantae | Fabaceae | Trifolium pauciflorum | Ref. |
| Plantae | Fabaceae | Trifolium phleoides | Ref. |
| Plantae | Fabaceae | Trifolium physodes | Ref. |
| Plantae | Fabaceae | Trifolium pignantii | Ref. |
| Plantae | Fabaceae | Trifolium plebeium | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium purpureum | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
| Plantae | Fabaceae | Trifolium retusum | Ref. |
| Plantae | Fabaceae | Trifolium rubens | Ref. |
| Plantae | Fabaceae | Trifolium rueppellianum | Ref. |
| Plantae | Fabaceae | Trifolium salmoneum | Ref. |
| Plantae | Fabaceae | Trifolium saxatile | Ref. |
| Plantae | Fabaceae | Trifolium scabrum | Ref. |
| Plantae | Fabaceae | Trifolium semipilosum | Ref. |
| Plantae | Fabaceae | Trifolium spumosum | Ref. |
| Plantae | Fabaceae | Trifolium squamosum | Ref. |
| Plantae | Fabaceae | Trifolium stellatum | Ref. |
| Plantae | Fabaceae | Trifolium striatum | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Trifolium suffocatum | Ref. |
| Plantae | Fabaceae | Trifolium sylvaticum | Ref. |
| Plantae | Fabaceae | Trifolium tenuifolium | Ref. |
| Plantae | Fabaceae | Trifolium thalii | Ref. |
| Plantae | Fabaceae | Trifolium tomentosum | Ref. |
| Plantae | Fabaceae | Trifolium trichocephalum | Ref. |
| Plantae | Fabaceae | Trifolium tumens | Ref. |
| Plantae | Fabaceae | Trifolium uniflorum | Ref. |
| Plantae | Fabaceae | Trifolium usambarense | Ref. |
| Plantae | Fabaceae | Trifolium vavilovii | Ref. |
| Plantae | Fabaceae | Trifolium vesiculosum | Ref. |
| Plantae | Fabaceae | Trifolium willdenovii | Ref. |
| Plantae | Fabaceae | Trifolium wormskioldii  | Ref. |
| Plantae | Fabaceae | Trigonella spp. | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vigna unguiculata  | Ref. |
| Plantae | Myristicaceae | Osteophloeum spp. | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Osteophleum platyspermum | Ref. |
| - | - | Swertzia madagascariensis | Ref. |
|
|
zoom in
| Organism | Astragalus mongholicus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Matsuda, et al., Planta Med, 70, (2004), 1201 |
|---|
|