| Name |
Cryptolepine |
| Formula |
C16H12N2 |
| Mw |
232.1000484 |
| CAS RN |
480-26-2 |
| C_ID |
C00001710
, 
|
| InChIKey |
KURWKDDWCJELSV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12N2/c1-18-15-9-5-2-6-11(15)10-14-16(18)12-7-3-4-8-13(12)17-14/h2-10H,1H3 |
| SMILES |
Cn1c2c3ccccc3nc-2cc2ccccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate L-Ala IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Cryptolepis sanguinolenta  | Ref. |
| Plantae | Apocynaceae | Cryptolepis triangularis | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Malvaceae | Sida acuta  | Ref. |
|
|
zoom in
| Organism | Sida acuta | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|