| Name |
(+)-Marmesin Marmesin |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
13849-08-6 |
| C_ID |
C00000584
, 
|
| InChIKey |
FWYSBEAFFPBAQU-STGVRZAANA-N |
| InChICode |
InChI=1S/C14H14O4/c1-14(2,16)12-6-9-5-8-3-4-13(15)18-10(8)7-11(9)17-12/h3-5,7,12,16H,6H2,1-2H3/t12-/m0/s1 |
| SMILES |
CC(C)(O)[C@@H]1Cc2cc3ccc(=O)oc3cc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ammi majus  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica pachycarpa | Ref. |
| Plantae | Apiaceae | Arracacia xanthorrhiza  | Ref. |
| Plantae | Apiaceae | Cachrys buchorica | Ref. |
| Plantae | Apiaceae | Ferulago capillaris | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Heracleum rapula | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Apiaceae | Peucedanum terebinthaceum | Ref. |
| Plantae | Apiaceae | Pleurospermum rivulorum | Ref. |
| Plantae | Apiaceae | Prangos bucharica | Ref. |
| Plantae | Apiaceae | Prangos latiloba | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Broussonetia papyrigera | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus cunninghamii | Ref. |
| Plantae | Moraceae | Ficus eriobotryoides | Ref. |
| Plantae | Moraceae | Ficus sycomorus  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum arnottianum | Ref. |
| Plantae | Rutaceae | Zanthoxylum belizense | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Angelica pachycarpa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Rao, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 26, (1991), 30.
Xiao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 423.
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kang, et al., Journal of Natural Products, 64, (2001), 683.
Lee, et al., Journal of Natural Products, 64, (2001), 1286.
Ahua, et al., Phytochemistry, 65, (2004), 963.
Jimenez, et al., Phytochemistry, 53, (2000), 1025.
Jang, et al., Journal of Natural Products, 66, (2003), 1166 |
|---|
|