| Name |
Procyanidin B2 Epicatechin-(4beta->8)-epicatechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
29106-49-8 |
| C_ID |
C00009077
, 
|
| InChIKey |
XFZJEEAOWLFHDH-ZPNYQRGRNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum burkwoodii | Ref. |
| Plantae | Apocynaceae | Ecdysanthera utilis | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Davalliaceae | Davallia mariesii | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Ericaceae | Vaccinium macrocarpon  | Ref. |
| Plantae | Ericaceae | Vaccinium myritillus | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Saraca asoca  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia Blume.  | Ref. |
| Plantae | Lauraceae | Cinnamomum obtusifolium Nees. | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Persea gratissima  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Guazuma ulmifolia  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L.  | Ref. |
| Plantae | Polygonaceae | Fagopyrum esculentum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum homotropicum | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Cotoneaster spp. | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var major  | Ref. |
| Plantae | Rosaceae | Crataegus spp. | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Malus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Thompson,J.Chem.Soc.Perkin Trans.,1,(1972),1387 |
|---|
|