| Name |
Patuletin 3,5,7,3',4'-Pentahydroxy-6-methoxyflavone 6-Methoxyquercetin 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
519-96-0 |
| C_ID |
C00004680
, 
|
| InChIKey |
JMIFIYIEXODVTO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Asteraceae | Achillea moschata | Ref. |
| Plantae | Asteraceae | Anthemis tinctoria  | Ref. |
| Plantae | Asteraceae | Arnica spp. | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia barrelieri | Ref. |
| Plantae | Asteraceae | Centaurea collina L. | Ref. |
| Plantae | Asteraceae | Centaurea incana | Ref. |
| Plantae | Asteraceae | Chrysactinia mexicana | Ref. |
| Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
| Plantae | Asteraceae | Eupatorium spp. | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Hemizonia spp. | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Pallenis spinosa | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tagetes patula  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon spp. | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus polyanthus | Ref. |
| Plantae | Fabaceae | Leucaena glauca  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
|
|
zoom in
| Organism | Fumaria officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|