| Name |
Thymonin Majoranin Mucroflavone B 5,6,4'-Trihydroxy-7,8,3'-trimethoxyflavone 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
76844-67-2 |
| C_ID |
C00003931
, 
|
| InChIKey |
BAIRXMVFPKLWSE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)15(22)17(24-2)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(O)c(OC)c(OC)c3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Madia capitata | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha longifolia  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Mentha spicata  | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Labiatae | Mentha suaveolens  | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Micromeria spp. | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum intercedens | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum spp. | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Satureja salzmannii | Ref. |
| Plantae | Labiatae | Thymus caespititius  | Ref. |
| Plantae | Labiatae | Thymus mastichina  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Acinos alpinus  | Ref. |
| Plantae | Lamiaceae | Acinos suaveolens | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Lamiaceae | Calamintha sylvatica  | Ref. |
| - | - | Majorana hortensis  | Ref. |
|
|
zoom in
| Organism | Thymus caespititius | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Van den Broocke,Phytochem.,21,(1982),2581
Hernandez,Biochem.Syst.Ecol.,15,(1987),6 |
|---|
|