| Name |
Galangin Norizalpinin 3,5,7-Trihydroxyflavone 3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
548-83-4 |
| C_ID |
C00004533
, 
|
| InChIKey |
VCCRNZQBSJXYJD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
| SMILES |
O=c1c(O)c(-c2ccccc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Cassinia quinquefaria | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Asteraceae | Helichrysum aureonitens | Ref. |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Heterothalamus psiadioides | Ref. |
| Plantae | Asteraceae | Odixia spp. | Ref. |
| Plantae | Betulaceae | Alnus pendula | Ref. |
| Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
| Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
| Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
| Plantae | Datiscaceae | Datisca cannabina  | Ref. |
| Plantae | Escalloniaceae | Escallonia spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Millettia racemosa  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Grossulariaceae | Ribes viscosissimum  | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum pampaninii | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria galericulata  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Salicaceae | Populus nigra  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga  | Ref. |
| Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Scutellaria galericulata | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Shin, et al., Journal of Natural Products, 65, (2002), 1315.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chi, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 31, (1996), 264. |
|---|
|