| Name |
Axillarin 3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone Quercetagetin 3,6-dimethyl ether 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
5188-73-8 |
| C_ID |
C00004684
, 
|
| InChIKey |
KIGVXRGRNLQNNI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia chamissonis | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia australis | Ref. |
| Plantae | Asteraceae | Asteriscus sericeus | Ref. |
| Plantae | Asteraceae | Bahia pringlei | Ref. |
| Plantae | Asteraceae | Calycadenia spp. | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
| Plantae | Asteraceae | Eriophyllum staechadifolium | Ref. |
| Plantae | Asteraceae | Flourensia hirsuta | Ref. |
| Plantae | Asteraceae | Gonospermum elegans | Ref. |
| Plantae | Asteraceae | Gonospermum gomerae | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Holocarpha heermannii | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Inula germanica  | Ref. |
| Plantae | Asteraceae | Iva axillaris | Ref. |
| Plantae | Asteraceae | Iva hayesiana | Ref. |
| Plantae | Asteraceae | Madia sativa  | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
| Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
| Plantae | Asteraceae | Tanacetum balsamita  | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Asteraceae | Tanacetum vulgare  | Ref. |
| Plantae | Asteraceae | Xanthium pensylvanicum | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Didiereaceae | Didierea spp. | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Rutaceae | Dictamnus albus  | Ref. |
|
|
zoom in
| Organism | Matricaria recutita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|